CymitQuimica logo

CAS 1227585-43-4

:

5-Bromo-4-(chloromethyl)-2-pyridinamine

Description:
5-Bromo-4-(chloromethyl)-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a chloromethyl group at the 4-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its functional groups suggest that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it valuable in medicinal chemistry and the development of pharmaceuticals. Additionally, the presence of halogen substituents can enhance its biological activity and influence its interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-4-(chloromethyl)-2-pyridinamine is a versatile intermediate in chemical synthesis with potential applications in drug discovery and development.
Formula:C6H6BrClN2
InChI:InChI=1S/C6H6BrClN2/c7-5-3-10-6(9)1-4(5)2-8/h1,3H,2H2,(H2,9,10)
InChI key:InChIKey=LGSVMYLMAORDTI-UHFFFAOYSA-N
SMILES:C(Cl)C=1C(Br)=CN=C(N)C1
Synonyms:
  • 2-Pyridinamine, 5-bromo-4-(chloromethyl)-
  • 5-Bromo-4-(chloromethyl)-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.