CAS 1227585-51-4

4-(Bromomethyl)-3-pyridinol

Description:

4-(Bromomethyl)-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group at the 4-position and a hydroxymethyl group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The bromomethyl group can serve as a versatile electrophile in nucleophilic substitution reactions, while the pyridinol moiety can participate in hydrogen bonding and coordination with metal ions. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 4-(Bromomethyl)-3-pyridinol is a valuable intermediate in the synthesis of various chemical entities, particularly in the pharmaceutical industry.

Formula: C₆H₆BrNO

InChI: InChI=1S/C6H6BrNO/c7-3-5-1-2-8-4-6(5)9/h1-2,4,9H,3H2

InChI key: InChIKey=LOCRXXUMEQBOKB-UHFFFAOYSA-N

SMILES: C(Br)C=1C(O)=CN=CC1

Synonyms:

• 3-Pyridinol, 4-(bromomethyl)-
• 4-(Bromomethyl)-3-pyridinol