CymitQuimica logo

CAS 1227585-55-8

:

4-(Bromomethyl)-3-methylpyridine

Description:
4-(Bromomethyl)-3-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group at the 4-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the bromine atom, which can participate in nucleophilic substitution reactions, making it useful in various synthetic applications, including the preparation of more complex organic molecules. The nitrogen atom in the pyridine ring can also engage in coordination with metal ions, enhancing its utility in coordination chemistry. Additionally, 4-(Bromomethyl)-3-methylpyridine may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its potential toxicity and reactivity, and it should be used in accordance with safety guidelines.
Formula:C7H8BrN
InChI:InChI=1S/C7H8BrN/c1-6-5-9-3-2-7(6)4-8/h2-3,5H,4H2,1H3
InChI key:InChIKey=ZALFRINWCREJLP-UHFFFAOYSA-N
SMILES:C(Br)C=1C(C)=CN=CC1
Synonyms:
  • 4-(Bromomethyl)-3-methylpyridine
  • Pyridine, 4-(bromomethyl)-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.