CymitQuimica logo

CAS 1227586-27-7

:

4-(Bromomethyl)-5-fluoro-2(1H)-pyridinone

Description:
4-(Bromomethyl)-5-fluoro-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a bromomethyl group and a fluorine atom. The presence of the bromomethyl group indicates that it can participate in nucleophilic substitution reactions, making it a potentially useful intermediate in organic synthesis. The fluorine atom contributes to the compound's reactivity and can influence its biological activity, as fluorinated compounds often exhibit unique pharmacological properties. This compound is likely to be a solid at room temperature, with moderate solubility in polar organic solvents due to the presence of the polar pyridinone functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridinones are known for their diverse biological activities. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 4-(Bromomethyl)-5-fluoro-2(1H)-pyridinone is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C6H5BrFNO
InChI:InChI=1S/C6H5BrFNO/c7-2-4-1-6(10)9-3-5(4)8/h1,3H,2H2,(H,9,10)
InChI key:InChIKey=BSHYEDDTILCRLI-UHFFFAOYSA-N
SMILES:C(Br)C=1C(F)=CNC(=O)C1
Synonyms:
  • 4-(Bromomethyl)-5-fluoro-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 4-(bromomethyl)-5-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.