CAS 1227587-13-4

3-(Bromomethyl)-5-(3-fluorophenyl)-2-pyridinamine

Description:

3-(Bromomethyl)-5-(3-fluorophenyl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both a bromomethyl group and a 3-fluorophenyl group. The presence of the bromomethyl group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The fluorine atom in the 3-fluorophenyl moiety can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. This compound may exhibit biological activity due to its amine functional group, which can engage in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 3-(Bromomethyl)-5-(3-fluorophenyl)-2-pyridinamine is a versatile compound with potential implications in various fields of chemistry and drug development.

Formula: C₁₂H₁₀BrFN₂

InChI: InChI=1S/C12H10BrFN2/c13-6-9-4-10(7-16-12(9)15)8-2-1-3-11(14)5-8/h1-5,7H,6H2,(H2,15,16)

InChI key: InChIKey=ALWMQPZIOFMYLH-UHFFFAOYSA-N

SMILES: C(Br)C1=CC(=CN=C1N)C2=CC(F)=CC=C2

Synonyms:

• 2-Pyridinamine, 3-(bromomethyl)-5-(3-fluorophenyl)-
• 3-(Bromomethyl)-5-(3-fluorophenyl)-2-pyridinamine