
CAS 1227587-82-7
:2,3-Difluoro-4-pyridineacetic acid
Description:
2,3-Difluoro-4-pyridineacetic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with two fluorine atoms at the 2 and 3 positions and a carboxylic acid group at the 4 position. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The fluorine substituents can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. It may be used in various applications, including pharmaceuticals and agrochemicals, due to its unique structural features. The presence of the pyridine ring suggests potential for coordination with metal ions, which could be relevant in catalysis or material science. As with many fluorinated compounds, it may exhibit distinct properties such as increased stability and altered lipophilicity compared to its non-fluorinated counterparts. Safety data should be consulted for handling and usage, as fluorinated compounds can have specific health and environmental considerations.
Formula:C7H5F2NO2
InChI:InChI=1S/C7H5F2NO2/c8-6-4(3-5(11)12)1-2-10-7(6)9/h1-2H,3H2,(H,11,12)
InChI key:InChIKey=IYYGPOVFCHKKCE-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C(F)=C(F)N=CC1
Synonyms:- 4-Pyridineacetic acid, 2,3-difluoro-
- 2,3-Difluoro-4-pyridineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.