CymitQuimica logo

CAS 1227591-90-3

:

2-(Trifluoromethyl)-4-pyridineacetonitrile

Description:
2-(Trifluoromethyl)-4-pyridineacetonitrile, with the CAS number 1227591-90-3, is an organic compound characterized by its pyridine ring and a trifluoromethyl group. This compound features a cyano group (-C≡N) attached to a pyridine derivative, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it a subject of interest in medicinal chemistry. Typically, compounds like this exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the presence of functional groups and the overall molecular structure. Additionally, the compound may exhibit polar characteristics due to the cyano group, affecting its solubility in different solvents. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, 2-(Trifluoromethyl)-4-pyridineacetonitrile is a valuable compound in synthetic organic chemistry.
Formula:C8H5F3N2
InChI:InChI=1S/C8H5F3N2/c9-8(10,11)7-5-6(1-3-12)2-4-13-7/h2,4-5H,1H2
InChI key:InChIKey=RCHDCXSMUCPNMT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CC#N)=CC=N1
Synonyms:
  • 4-Pyridineacetonitrile, 2-(trifluoromethyl)-
  • 2-(Trifluoromethyl)-4-pyridineacetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.