CymitQuimica logo

CAS 1227592-44-0

:

3-Bromo-4-pyridineacetic acid

Description:
3-Bromo-4-pyridineacetic acid is an organic compound characterized by its pyridine ring and a carboxylic acid functional group. It features a bromine atom substituted at the 3-position of the pyridine ring and an acetic acid moiety at the 4-position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom may enhance its reactivity and influence its biological activity. Additionally, 3-Bromo-4-pyridineacetic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as with many brominated compounds, it may pose health risks if not managed properly.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c8-6-4-9-2-1-5(6)3-7(10)11/h1-2,4H,3H2,(H,10,11)
InChI key:InChIKey=ZUJPGXQSUZZIKX-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C(Br)=CN=CC1
Synonyms:
  • 2-(3-Bromopyridin-4-yl)acetic acid
  • (3-Bromo-pyridin-4-yl)-acetic acid
  • 3-Bromo-4-pyridineacetic acid
  • 4-Pyridineacetic acid, 3-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.