CAS 1227592-82-6

6-Chloro-5-methyl-2(1H)-pyridinone

Description:

6-Chloro-5-methyl-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which includes a chlorine substituent at the 6-position and a methyl group at the 5-position of the pyridine ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the chlorine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the methyl group may affect the compound's steric properties and overall stability. As a pyridinone derivative, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's unique characteristics make it a valuable candidate for further studies in medicinal chemistry and related fields. However, specific safety and handling guidelines should be followed due to its chemical nature.

Formula: C₆H₆ClNO

InChI: InChI=1S/C6H6ClNO/c1-4-2-3-5(9)8-6(4)7/h2-3H,1H3,(H,8,9)

InChI key: InChIKey=MHOYCWKBVPVKQH-UHFFFAOYSA-N

SMILES: ClC1=C(C)C=CC(=O)N1

Synonyms:

• 6-Chloro-5-methyl-2(1H)-pyridinone
• 2(1H)-Pyridinone, 6-chloro-5-methyl-