CAS 1227592-96-2

2,6-Dibromo-3-pyridineacetic acid

Description:

2,6-Dibromo-3-pyridineacetic acid is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2 and 6 positions with bromine atoms, and at the 3 position with an acetic acid group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential acidity due to the carboxylic acid group. The presence of bromine atoms can influence its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. It may also exhibit biological activity, which can be attributed to the pyridine moiety and the electron-withdrawing nature of the bromine substituents. The compound is likely to be soluble in polar solvents and may have varying solubility in non-polar solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₇H₅Br₂NO₂

InChI: InChI=1S/C7H5Br2NO2/c8-5-2-1-4(3-6(11)12)7(9)10-5/h1-2H,3H2,(H,11,12)

InChI key: InChIKey=FQXZOJZNEJETSN-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(Br)N=C(Br)C=C1

Synonyms:

• 3-Pyridineacetic acid, 2,6-dibromo-
• 2,6-Dibromo-3-pyridineacetic acid