CymitQuimica logo

CAS 1227593-99-8

:

4-Fluoro-5-methyl-2(1H)-pyridinone

Description:
4-Fluoro-5-methyl-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which includes a pyridine ring with a ketone functional group and additional substituents. The presence of a fluorine atom at the 4-position and a methyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the polar carbonyl group. It is of interest in medicinal chemistry and pharmaceutical research, potentially serving as a building block for the synthesis of biologically active molecules. The compound may also display various reactivity patterns typical of pyridinones, such as nucleophilic substitution and coordination with metal ions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 4-Fluoro-5-methyl-2(1H)-pyridinone represents a valuable compound in organic synthesis and drug development.
Formula:C6H6FNO
InChI:InChI=1S/C6H6FNO/c1-4-3-8-6(9)2-5(4)7/h2-3H,1H3,(H,8,9)
InChI key:InChIKey=SCXNWAMKQDHZFE-UHFFFAOYSA-N
SMILES:FC=1C(C)=CNC(=O)C1
Synonyms:
  • 2(1H)-Pyridinone, 4-fluoro-5-methyl-
  • 4-Fluoro-5-methyl-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.