CAS 1227594-36-6

3-(Chloromethyl)-2,4-difluoropyridine

Description:

3-(Chloromethyl)-2,4-difluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with both fluorine and chloromethyl groups. The presence of two fluorine atoms at the 2 and 4 positions of the pyridine ring enhances its reactivity and polarity, making it useful in various chemical syntheses and applications. The chloromethyl group, located at the 3 position, serves as a versatile functional group that can undergo nucleophilic substitution reactions, facilitating further modifications of the molecule. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it suitable for use in organic synthesis and pharmaceutical applications. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks due to its halogenated nature. Overall, 3-(Chloromethyl)-2,4-difluoropyridine is a valuable intermediate in the synthesis of various biologically active compounds and agrochemicals.

Formula: C₆H₄ClF₂N

InChI: InChI=1S/C6H4ClF2N/c7-3-4-5(8)1-2-10-6(4)9/h1-2H,3H2

InChI key: InChIKey=BGCDBMCSEYDBDB-UHFFFAOYSA-N

SMILES: C(Cl)C=1C(F)=CC=NC1F

Synonyms:

• 3-(Chloromethyl)-2,4-difluoropyridine
• Pyridine, 3-(chloromethyl)-2,4-difluoro-