
CAS 1227594-56-0
:2-Fluoro-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Description:
2-Fluoro-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the second position and a carboxylic acid functional group at the third position contributes to its unique reactivity and potential applications in medicinal chemistry. The compound features a keto group at the sixth position, which can influence its tautomeric forms and stability. Its dihydro form indicates that it has two hydrogen atoms added to the ring, affecting its physical properties such as solubility and boiling point. This compound may exhibit biological activity, making it of interest in drug development and synthesis. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, including nucleophilic substitutions and acid-base reactions. Overall, 2-Fluoro-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a versatile compound with significant implications in organic synthesis and pharmaceutical research.
Formula:C6H4FNO3
InChI:InChI=1S/C6H4FNO3/c7-5-3(6(10)11)1-2-4(9)8-5/h1-2H,(H,8,9)(H,10,11)
InChI key:InChIKey=BJUPBAIIOBVDFQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)NC(=O)C=C1
Synonyms:- 2-Fluoro-6-hydroxypyridine-3-carboxylic acid
- 2-Fluoro-6-oxo-1,6-dihydropyridine-3-carboxylic acid
- 2-Fluoro-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-fluoro-1,6-dihydro-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.