CAS 1227594-84-4

Methyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-4-pyridinecarboxylate

Description:

Methyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-4-pyridinecarboxylate, identified by its CAS number 1227594-84-4, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a dihydro-2-oxo group, indicating the presence of a carbonyl functional group (C=O) adjacent to a saturated carbon atom, contributing to its reactivity and potential applications in organic synthesis. The trifluoromethyl group (-CF3) attached to the pyridine ring enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the methyl ester functional group (-COOCH3) suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may have different properties and applications. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₆F₃NO₃

InChI: InChI=1S/C8H6F3NO3/c1-15-7(14)4-2-6(13)12-3-5(4)8(9,10)11/h2-3H,1H3,(H,12,13)

InChI key: InChIKey=VXGVIOWBIBBZRZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(C(OC)=O)=CC(=O)NC1

Synonyms:

• Methyl 1,2-dihydro-2-oxo-5-(trifluoromethyl)-4-pyridinecarboxylate
• 4-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-5-(trifluoromethyl)-, methyl ester