
CAS 1227594-95-7
:4-(Bromomethyl)-2-methoxy-5-(trifluoromethyl)pyridine
Description:
4-(Bromomethyl)-2-methoxy-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromomethyl group, a methoxy group, and a trifluoromethyl group, which contribute to its unique chemical properties. The presence of the bromomethyl group enhances its reactivity, making it a potential intermediate in various organic synthesis reactions. The methoxy group can influence the compound's solubility and polarity, while the trifluoromethyl group is known for imparting significant electronic effects, often enhancing the compound's lipophilicity and stability. This compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry. Additionally, its specific functional groups can lead to diverse applications in agrochemicals and materials science. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C8H7BrF3NO
InChI:InChI=1S/C8H7BrF3NO/c1-14-7-2-5(3-9)6(4-13-7)8(10,11)12/h2,4H,3H2,1H3
InChI key:InChIKey=BTBZORKXPABXPM-UHFFFAOYSA-N
SMILES:C(Br)C=1C(C(F)(F)F)=CN=C(OC)C1
Synonyms:- 4-(Bromomethyl)-2-methoxy-5-(trifluoromethyl)pyridine
- Pyridine, 4-(bromomethyl)-2-methoxy-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.