CymitQuimica logo

CAS 1227595-10-9

:

3-(Bromomethyl)-6-methyl-2-pyridinamine

Description:
3-(Bromomethyl)-6-methyl-2-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group indicates that a bromomethyl substituent is attached to the third carbon of the pyridine ring, while a methyl group is located at the sixth position. This compound is classified as an amine due to the presence of an amino group (-NH2) at the second position of the pyridine ring. The bromomethyl group can serve as a reactive site for further chemical modifications, making it useful in synthetic organic chemistry. The compound's properties, such as solubility, boiling point, and reactivity, are influenced by the electron-withdrawing nature of the bromine atom and the electron-donating properties of the amino and methyl groups. Overall, 3-(Bromomethyl)-6-methyl-2-pyridinamine is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and synthesis.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-5-2-3-6(4-8)7(9)10-5/h2-3H,4H2,1H3,(H2,9,10)
InChI key:InChIKey=HCQQKRRQDXEEOK-UHFFFAOYSA-N
SMILES:C(Br)C1=C(N)N=C(C)C=C1
Synonyms:
  • 3-(Bromomethyl)-6-methyl-2-pyridinamine
  • 2-Pyridinamine, 3-(bromomethyl)-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.