CymitQuimica logo

CAS 1227595-16-5

:

Methyl 2-methoxy-5-(trifluoromethyl)-4-pyridinecarboxylate

Description:
Methyl 2-methoxy-5-(trifluoromethyl)-4-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to the pyridine ring, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its reactivity and biological activity. Methyl esters, like this compound, are generally known for their stability and can participate in various chemical reactions, including nucleophilic substitutions and esterification. The molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's specific functional groups may impart distinctive characteristics such as solubility in organic solvents and potential interactions with biological targets. As with many fluorinated compounds, it may exhibit unique electronic properties due to the electronegative fluorine atoms, which can affect its behavior in chemical reactions and interactions.
Formula:C9H8F3NO3
InChI:InChI=1S/C9H8F3NO3/c1-15-7-3-5(8(14)16-2)6(4-13-7)9(10,11)12/h3-4H,1-2H3
InChI key:InChIKey=OFUWNFBUQBUQKY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(C(F)(F)F)=CN=C(OC)C1
Synonyms:
  • 4-Pyridinecarboxylic acid, 2-methoxy-5-(trifluoromethyl)-, methyl ester
  • Methyl 2-methoxy-5-(trifluoromethyl)-4-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.