CymitQuimica logo

CAS 1227595-33-6

:

4-Amino-5-chloro-2(1H)-pyridinone

Description:
4-Amino-5-chloro-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridine ring structure, which contains both an amino group and a chloro substituent. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is soluble in polar solvents, such as water and alcohols, due to the presence of the amino group, which can engage in hydrogen bonding. The chloro substituent can influence the compound's reactivity and stability, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of the amino group also suggests potential biological activity, which may be explored in pharmaceutical applications. Additionally, the compound's structure allows for various functionalization possibilities, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C5H5ClN2O
InChI:InChI=1S/C5H5ClN2O/c6-3-2-8-5(9)1-4(3)7/h1-2H,(H3,7,8,9)
InChI key:InChIKey=JFVXIFYBTNNNAN-UHFFFAOYSA-N
SMILES:NC=1C(Cl)=CNC(=O)C1
Synonyms:
  • 4-Amino-5-chloro-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 4-amino-5-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.