CymitQuimica logo

CAS 1227595-84-7

:

4-Fluoro-6-methyl-2-pyridinamine

Description:
4-Fluoro-6-methyl-2-pyridinamine, with the CAS number 1227595-84-7, is an organic compound belonging to the class of pyridinamines. It features a pyridine ring substituted with a fluorine atom at the 4-position and a methyl group at the 6-position, along with an amino group at the 2-position. This compound is characterized by its potential biological activity, which may include roles in medicinal chemistry and drug development. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the amino group may contribute to hydrogen bonding interactions in biological systems. Its molecular structure suggests it may exhibit properties such as solubility in polar solvents and potential reactivity in various chemical reactions. As with many pyridine derivatives, it may also participate in nucleophilic substitution reactions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C6H7FN2
InChI:InChI=1S/C6H7FN2/c1-4-2-5(7)3-6(8)9-4/h2-3H,1H3,(H2,8,9)
InChI key:InChIKey=XMWBQAISFSMRLR-UHFFFAOYSA-N
SMILES:FC=1C=C(C)N=C(N)C1
Synonyms:
  • 2-Pyridinamine, 4-fluoro-6-methyl-
  • 4-Fluoro-6-methyl-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.