CAS 1227596-12-4
:5-Iodo-6-(trifluoromethyl)-2-pyridinamine
Description:
5-Iodo-6-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with an iodine atom and a trifluoromethyl group. The presence of the iodine atom contributes to its potential reactivity and biological activity, while the trifluoromethyl group enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its molecular structure suggests potential applications in areas such as agrochemicals or as a building block in organic synthesis. The compound's properties, including solubility, stability, and reactivity, can be influenced by the electronic effects of the iodine and trifluoromethyl groups. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 5-Iodo-6-(trifluoromethyl)-2-pyridinamine represents a valuable compound in the field of chemical research and development.
Formula:C6H4F3IN2
InChI:InChI=1S/C6H4F3IN2/c7-6(8,9)5-3(10)1-2-4(11)12-5/h1-2H,(H2,11,12)
InChI key:InChIKey=OQZVGYFPJGTYPR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(I)C=CC(N)=N1
Synonyms:- 2-Pyridinamine, 5-iodo-6-(trifluoromethyl)-
- 5-Iodo-6-(trifluoromethyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
