
CAS 1227599-66-7
:6-Chloro[2,3′-bipyridine]-5-carboxaldehyde
Description:
6-Chloro[2,3′-bipyridine]-5-carboxaldehyde is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 2 and 3 positions. The presence of a chloro substituent at the 6-position and an aldehyde functional group at the 5-position significantly influences its reactivity and properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to its polar functional groups. It may participate in various chemical reactions, including nucleophilic additions and condensation reactions, owing to the aldehyde group. Additionally, the chloro substituent can enhance its reactivity in electrophilic aromatic substitution reactions. The compound's unique structure makes it of interest in medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a ligand in coordination chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C11H7ClN2O
InChI:InChI=1S/C11H7ClN2O/c12-11-9(7-15)3-4-10(14-11)8-2-1-5-13-6-8/h1-7H
InChI key:InChIKey=GMXZHLJOFZMJGZ-UHFFFAOYSA-N
SMILES:ClC1=NC(=CC=C1C=O)C=2C=CC=NC2
Synonyms:- 6-Chloro[2,3′-bipyridine]-5-carboxaldehyde
- [2,3′-Bipyridine]-5-carboxaldehyde, 6-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.