CAS 1227599-90-7

3-Bromo-5-methoxy-4-pyridinemethanol

Description:

3-Bromo-5-methoxy-4-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a methoxy group at the 5-position contributes to its unique reactivity and properties. The hydroxymethyl group at the 4-position enhances its potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups. Additionally, safety and handling considerations are essential, as halogenated compounds can pose health risks. Overall, 3-Bromo-5-methoxy-4-pyridinemethanol is a versatile compound with potential applications in research and industry.

Formula: C₇H₈BrNO₂

InChI: InChI=1S/C7H8BrNO2/c1-11-7-3-9-2-6(8)5(7)4-10/h2-3,10H,4H2,1H3

InChI key: InChIKey=ASBWPXIBCBDDBR-UHFFFAOYSA-N

SMILES: O(C)C=1C(CO)=C(Br)C=NC1

Synonyms:

• 3-Bromo-5-methoxy-4-pyridinemethanol
• 4-Pyridinemethanol, 3-bromo-5-methoxy-

(3-Bromo-5-methoxypyridin-4-yl)methanol

CAS: 1227599-90-7

Versatile small molecule scaffold

Formula: C₇H₈BrNO₂

Purity: Min. 95%

Molecular weight: 218.05 g/mol

Ref: 3D-CZB59990