CAS 122760-84-3

4-Methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol

Description:

4-Methyl-8-methylenetricyclo[3.3.1.1^3,7]decan-2-ol, with the CAS number 122760-84-3, is a bicyclic organic compound characterized by its complex tricyclic structure. This compound features a hydroxyl (-OH) functional group, which contributes to its classification as an alcohol. The presence of the methyl and methylene groups indicates that it has multiple substituents, influencing its physical and chemical properties, such as solubility and reactivity. Typically, compounds of this nature may exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding. The unique tricyclic framework can impart rigidity to the molecule, potentially affecting its conformational flexibility and steric interactions. Additionally, such compounds may be of interest in synthetic organic chemistry and materials science due to their potential applications in pharmaceuticals or as intermediates in chemical synthesis. However, specific reactivity, stability, and biological activity would require further investigation through experimental studies.

Formula: C₁₂H₁₈O

InChI: InChI=1S/C12H18O/c1-6-8-3-9-5-10(6)12(13)11(4-8)7(9)2/h7-13H,1,3-5H2,2H3

InChI key: InChIKey=REINJUBMDBESCN-UHFFFAOYSA-N

SMILES: OC1C2C(C)C3CC1C(=C)C(C2)C3

Synonyms:

• Tricyclo[3.3.1.13,7]decan-2-ol, 4-methyl-8-methylene-
• Prismantol
• 4-Methyl-8-methyleneadamantan-2-ol
• 4-Methyl-8-methylenetricyclo[3.3.1.13,7]decan-2-ol

Tricyclo[3.3.1.13,7]decan-2-ol, 4-methyl-8-methylene-

CAS: 122760-84-3

Formula: C₁₂H₁₈O

Molecular weight: 178.2707

Ref: IN-DA000JEB