
CAS 122760-85-4
:Tricyclo[3.3.1.13,7]decan-2-ol, 4-methyl-8-methylene-, 2-acetate
Description:
Tricyclo[3.3.1.1^3,7]decan-2-ol, 4-methyl-8-methylene-, 2-acetate, with the CAS number 122760-85-4, is a complex organic compound characterized by its unique tricyclic structure. This compound features a bicyclic framework with a hydroxyl group (-OH) and an acetate functional group (-OCOCH3), contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl and methylene groups enhances its steric properties, influencing its physical and chemical behavior. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have specific optical activity due to their chiral centers. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, owing to its ability to interact with biological systems. Additionally, its stability and reactivity can be influenced by environmental factors such as temperature and pH, making it a subject of interest for further research in synthetic and applied chemistry.
Formula:C14H20O2
InChI:InChI=1S/C14H20O2/c1-7-10-4-11-6-12(7)14(16-9(3)15)13(5-10)8(11)2/h8,10-14H,1,4-6H2,2-3H3
InChI key:InChIKey=HYZYPKCUAUVUJO-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1C2C(C)C3CC1C(=C)C(C2)C3
Synonyms:- Tricyclo[3.3.1.13,7]decan-2-ol, 4-methyl-8-methylene-, 2-acetate
- Tricyclo[3.3.1.13,7]decan-2-ol, 4-methyl-8-methylene-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tricyclo[3.3.1.13,7]decan-2-ol, 4-methyl-8-methylene-, 2-acetate
CAS:Formula:C14H20O2Molecular weight:220.3074
