CymitQuimica logo

CAS 1227600-89-6

:

2-Methoxy[3,3′-bipyridine]-5-carboxaldehyde

Description:
2-Methoxy[3,3′-bipyridine]-5-carboxaldehyde is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methoxy group (-OCH3) at one position and an aldehyde group (-CHO) at another position on the bipyridine framework contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits moderate solubility in organic solvents due to its polar functional groups, while its aromatic nature may provide stability and facilitate π-π interactions. The aldehyde functionality allows for further derivatization, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the methoxy group can influence the electronic properties of the bipyridine system, potentially affecting its behavior in coordination chemistry and catalysis. Overall, 2-Methoxy[3,3′-bipyridine]-5-carboxaldehyde is a valuable compound in research settings, particularly in the development of new pharmaceuticals and agrochemicals.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-16-12-11(5-9(8-15)6-14-12)10-3-2-4-13-7-10/h2-8H,1H3
InChI key:InChIKey=WRENYPSDXHUVGK-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(C=O)C=N1)C=2C=CC=NC2
Synonyms:
  • 2-Methoxy[3,3′-bipyridine]-5-carboxaldehyde
  • [3,3′-Bipyridine]-5-carboxaldehyde, 2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.