CAS 1227601-37-7

3-(Difluoromethoxy)-6-(trifluoromethyl)-2-pyridinecarboxaldehyde

Description:

3-(Difluoromethoxy)-6-(trifluoromethyl)-2-pyridinecarboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with both difluoromethoxy and trifluoromethyl groups. The presence of these fluorinated groups enhances its lipophilicity and may influence its reactivity and biological activity. The aldehyde functional group contributes to its potential as a reactive intermediate in organic synthesis, allowing for further derivatization. This compound is likely to exhibit unique physical properties, such as a relatively high boiling point and low solubility in water, typical of fluorinated organic compounds. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, particularly in the development of compounds with specific electronic or steric properties. Safety and handling considerations are important due to the presence of fluorine, which can impart toxicity and environmental persistence. As with any chemical, proper safety protocols should be followed when handling this substance in a laboratory setting.

Formula: C₈H₄F₅NO₂

InChI: InChI=1S/C8H4F5NO2/c9-7(10)16-5-1-2-6(8(11,12)13)14-4(5)3-15/h1-3,7H

InChI key: InChIKey=LDVCTHPXFUCEFR-UHFFFAOYSA-N

SMILES: C(=O)C1=C(OC(F)F)C=CC(C(F)(F)F)=N1

Synonyms:

• 2-Pyridinecarboxaldehyde, 3-(difluoromethoxy)-6-(trifluoromethyl)-
• 3-(Difluoromethoxy)-6-(trifluoromethyl)-2-pyridinecarboxaldehyde