CAS 1227601-48-0: 5,6-Dichloro-2-pyridinemethanol

Description: 5,6-Dichloro-2-pyridinemethanol is an organic compound characterized by its pyridine ring structure, which is substituted with two chlorine atoms at the 5 and 6 positions and a hydroxymethyl group at the 2 position. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the hydroxyl group. The dichloro substitutions enhance its reactivity, making it useful in various chemical syntheses and applications, particularly in medicinal chemistry and agrochemicals. The presence of the pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often found in pharmaceuticals. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 5,6-Dichloro-2-pyridinemethanol is a significant compound in organic synthesis and research.

Formula: C₆H₅Cl₂NO

InChI: InChI=1S/C6H5Cl2NO/c7-5-2-1-4(3-10)9-6(5)8/h1-2,10H,3H2

InChI key: InChIKey=GQGAIINAEFCDJC-UHFFFAOYSA-N

SMILES: ClC=1N=C(C=CC1Cl)CO

Synonyms:

• 2-Pyridinemethanol, 5,6-dichloro-
• 5,6-Dichloro-2-pyridinemethanol

(5,6-Dichloropyridin-2-yl)methanol

CAS: 1227601-48-0

• Purity: 95+%
• Molecular weight: 178.00999450683594

(5,6-Dichloropyridin-2-yl)methanol

CAS: 1227601-48-0

Versatile small molecule scaffold

• Formula: C₆H₅Cl₂NO
• Purity: Min. 95%
• Molecular weight: 178.01 g/mol