CAS 1227602-44-9

2,3-Dimethoxy-4-methylpyridine

Description:

2,3-Dimethoxy-4-methylpyridine is an organic compound belonging to the class of pyridines, which are aromatic heterocyclic compounds containing a nitrogen atom in the ring. This particular compound features two methoxy groups (-OCH3) at the 2 and 3 positions and a methyl group (-CH3) at the 4 position of the pyridine ring. It is characterized by its molecular formula, which reflects the presence of carbon, hydrogen, and nitrogen atoms. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the methoxy groups. 2,3-Dimethoxy-4-methylpyridine may be used in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₁₁NO₂

InChI: InChI=1S/C8H11NO2/c1-6-4-5-9-8(11-3)7(6)10-2/h4-5H,1-3H3

InChI key: InChIKey=NUHOFYAVLFMJKA-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C(C)=CC=N1

Synonyms:

• 2,3-Dimethoxy-4-methylpyridine
• Pyridine, 2,3-dimethoxy-4-methyl-