CAS 1227603-30-6

5-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxaldehyde

Description:

5-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and an aldehyde functional group at the 2-position contributes to its reactivity and potential applications in organic synthesis. The compound features a keto group at the 6-position, which enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic additions. Its molecular structure suggests it may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As with many brominated compounds, it may also exhibit specific interactions with biological systems, warranting further investigation into its toxicological profile and environmental impact. Overall, 5-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxaldehyde is a versatile compound with significant implications in chemical research and development.

Formula: C₆H₄BrNO₂

InChI: InChI=1S/C6H4BrNO2/c7-5-2-1-4(3-9)8-6(5)10/h1-3H,(H,8,10)

InChI key: InChIKey=BKUFWUXNTIOBTL-UHFFFAOYSA-N

SMILES: C(=O)C=1NC(=O)C(Br)=CC1

Synonyms:

• 2-Pyridinecarboxaldehyde, 5-bromo-1,6-dihydro-6-oxo-
• 5-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxaldehyde