CAS 1227606-48-5

2-Phenyl-4-pyridineacetonitrile

Description:

2-Phenyl-4-pyridineacetonitrile, identified by its CAS number 1227606-48-5, is an organic compound characterized by its unique structure, which includes a pyridine ring and a phenyl group attached to an acetonitrile moiety. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, particularly due to the presence of the pyridine ring, which is known for its biological activity. The compound may exhibit various chemical properties, including reactivity towards electrophiles and nucleophiles, making it a candidate for further chemical transformations. Additionally, its nitrile functional group can participate in reactions such as hydrolysis or reduction, leading to the formation of carboxylic acids or amines, respectively. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, 2-Phenyl-4-pyridineacetonitrile represents a versatile compound with potential utility in synthetic organic chemistry.

Formula: C₁₃H₁₀N₂

InChI: InChI=1S/C13H10N2/c14-8-6-11-7-9-15-13(10-11)12-4-2-1-3-5-12/h1-5,7,9-10H,6H2

InChI key: InChIKey=BYPMHGOCFDWSTL-UHFFFAOYSA-N

SMILES: C(C#N)C=1C=C(N=CC1)C2=CC=CC=C2

Synonyms:

• 4-Pyridineacetonitrile, 2-phenyl-
• 2-Phenyl-4-pyridineacetonitrile