
CAS 1227606-76-9
:5-Bromo-6-(chloromethyl)-2(1H)-pyridinone
Description:
5-Bromo-6-(chloromethyl)-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a bromine atom and a chloromethyl group attached to the pyridine ring. This compound typically exhibits properties associated with halogenated pyridines, such as increased reactivity due to the presence of the bromine and chlorine substituents. It is likely to be a solid at room temperature and may be soluble in polar organic solvents. The presence of the bromine and chloromethyl groups can influence its chemical behavior, making it a potential candidate for various synthetic applications, including medicinal chemistry and agrochemical development. Additionally, the compound may exhibit biological activity, which could be of interest in pharmacological research. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns. Overall, 5-Bromo-6-(chloromethyl)-2(1H)-pyridinone is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H5BrClNO
InChI:InChI=1S/C6H5BrClNO/c7-4-1-2-6(10)9-5(4)3-8/h1-2H,3H2,(H,9,10)
InChI key:InChIKey=NCFUGWYOMUDZAD-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(Br)C=CC(=O)N1
Synonyms:- 2(1H)-Pyridinone, 5-bromo-6-(chloromethyl)-
- 5-Bromo-6-(chloromethyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.