CAS 1227607-66-0

5-Chloro-2-fluoro-4-pyridineacetonitrile

Description:

5-Chloro-2-fluoro-4-pyridineacetonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of chlorine and fluorine substituents at specific positions on the pyridine ring contributes to its unique reactivity and properties. This compound features a nitrile functional group (-C≡N), which is known for its polar character and ability to participate in various chemical reactions, including nucleophilic additions and condensation reactions. The molecular structure suggests that it may exhibit moderate to high lipophilicity, influencing its solubility in organic solvents. Additionally, the presence of halogens can enhance its biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's CAS number, 1227607-66-0, allows for precise identification in chemical databases, facilitating its study and application in various fields, including medicinal chemistry and material science. Overall, 5-Chloro-2-fluoro-4-pyridineacetonitrile is a versatile compound with potential applications due to its distinctive chemical characteristics.

Formula: C₇H₄ClFN₂

InChI: InChI=1S/C7H4ClFN2/c8-6-4-11-7(9)3-5(6)1-2-10/h3-4H,1H2

InChI key: InChIKey=CRSZMPGNGNSCLR-UHFFFAOYSA-N

SMILES: C(C#N)C=1C(Cl)=CN=C(F)C1

Synonyms:

• 5-Chloro-2-fluoro-4-pyridineacetonitrile
• 4-Pyridineacetonitrile, 5-chloro-2-fluoro-