CAS 1227607-77-3

5-Fluoro-6-methoxy-3-pyridineacetonitrile

Description:

5-Fluoro-6-methoxy-3-pyridineacetonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a methoxy group at the 6-position contributes to its unique chemical properties and reactivity. The acetonitrile functional group enhances its polarity and solubility in polar solvents. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both halogen and methoxy substituents can influence its electronic properties, potentially affecting its behavior in chemical reactions. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity and environmental impact. Overall, 5-Fluoro-6-methoxy-3-pyridineacetonitrile represents a versatile building block in organic synthesis and drug discovery.

Formula: C₈H₇FN₂O

InChI: InChI=1S/C8H7FN2O/c1-12-8-7(9)4-6(2-3-10)5-11-8/h4-5H,2H2,1H3

InChI key: InChIKey=UTMVAVNXCYWJOD-UHFFFAOYSA-N

SMILES: C(C#N)C=1C=C(F)C(OC)=NC1

Synonyms:

• 3-Pyridineacetonitrile, 5-fluoro-6-methoxy-
• 5-Fluoro-6-methoxy-3-pyridineacetonitrile