CAS 1227607-85-3
:5,6-Difluoro-3-pyridineacetic acid
Description:
5,6-Difluoro-3-pyridineacetic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with two fluorine atoms at the 5 and 6 positions and a carboxylic acid group at the 3 position. This compound belongs to the class of pyridine derivatives and exhibits properties typical of both aromatic and carboxylic acid functionalities. The presence of fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The compound's molecular structure contributes to its unique chemical behavior, including potential interactions with biological targets. Additionally, the presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the fluorine substituents may affect its electronic properties and stability. As with any chemical substance, safety data and handling precautions should be considered when working with 5,6-Difluoro-3-pyridineacetic acid.
Formula:C7H5F2NO2
InChI:InChI=1S/C7H5F2NO2/c8-5-1-4(2-6(11)12)3-10-7(5)9/h1,3H,2H2,(H,11,12)
InChI key:InChIKey=KNBDNCUKHMNFIN-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=C(F)C(F)=NC1
Synonyms:- 3-Pyridineacetic acid, 5,6-difluoro-
- (5,6-Difluoropyridin-3-yl)acetic acid
- 5,6-Difluoro-3-pyridineacetic acid
- 2-(5,6-Difluoropyridin-3-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
