CAS 1227607-99-9: 4-Bromo-6-fluoroisoquinolin-1(2H)-one

Description:4-Bromo-6-fluoroisoquinolin-1(2H)-one is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring. The presence of bromine and fluorine substituents at the 4 and 6 positions, respectively, contributes to its unique chemical properties, including potential reactivity and biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic nature. The bromine atom can enhance the compound's lipophilicity, while the fluorine atom may influence its electronic properties, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the carbonyl group in the isoquinolinone structure can participate in hydrogen bonding, affecting its interactions with biological targets. Overall, 4-Bromo-6-fluoroisoquinolin-1(2H)-one is a compound of interest for research in pharmaceuticals, particularly in the development of new therapeutic agents.

Formula:C₉H₅NOBrF

InChI:InChI=1S/C9H5BrFNO/c10-8-4-12-9(13)6-2-1-5(11)3-7(6)8/h1-4H,(H,12,13)

Synonyms:
1(2H)-isoquinolinone, 4-bromo-6-fluoro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1(2H)-Isoquinolinone, 4-bromo-6-fluoro- REF: IN-DA000JEFCAS: 1227607-99-9	95%	To inquire	Tue 04 Mar 25
4-Bromo-6-fluoroisoquinolin-1(2H)-one REF: 10-F225150CAS: 1227607-99-9	95.0%	76.00 €~1,700.00 €	Wed 05 Mar 25
4-Bromo-6-fluoroisoquinolin-1(2H)-one REF: 54-PC535064CAS: 1227607-99-9	95+%	93.00 €~1,134.00 €	Tue 11 Mar 25
4-Bromo-6-fluoroisoquinolin-1(2H)-one REF: 3D-CZB60799CAS: 1227607-99-9	Min. 95%	- - -	Discontinued product