CAS 1227608-07-2
:3,4-Dimethylthiophene-2-sulfonyl chloride
Description:
3,4-Dimethylthiophene-2-sulfonyl chloride is an organosulfur compound characterized by the presence of a thiophene ring substituted with two methyl groups and a sulfonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. The presence of the thiophene ring contributes to its aromatic properties, influencing its stability and reactivity. Additionally, the methyl groups can affect the electronic distribution within the molecule, potentially enhancing its nucleophilicity. This compound is often utilized in the synthesis of various pharmaceuticals and agrochemicals, as well as in the development of functional materials. Safety precautions are necessary when handling this substance, as it can be corrosive and may cause irritation to the skin and eyes. Proper storage and handling protocols should be followed to mitigate any risks associated with its use.
Formula:C6H7ClO2S2
InChI:InChI=1S/C6H7ClO2S2/c1-4-3-10-6(5(4)2)11(7,8)9/h3H,1-2H3
SMILES:Cc1csc(c1C)S(=O)(=O)Cl
Synonyms:- 2-Thiophenesulfonyl Chloride, 3,4-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
