CAS 1227626-46-1

Methyl 4-acetyl-2-propyl-1H-imidazole-5-carboxylate

Description:

Methyl 4-acetyl-2-propyl-1H-imidazole-5-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of an acetyl group and a propyl chain enhances its molecular complexity and may influence its reactivity and interactions with biological systems. Typically, compounds of this nature may exhibit properties such as moderate polarity, potential biological activity, and the ability to participate in various chemical reactions, including esterification and acylation. The specific arrangement of substituents on the imidazole ring can affect its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and boiling point would depend on its molecular interactions and the presence of functional groups. Overall, Methyl 4-acetyl-2-propyl-1H-imidazole-5-carboxylate represents a unique structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₄N₂O₃

InChI: InChI=1S/C10H14N2O3/c1-4-5-7-11-8(6(2)13)9(12-7)10(14)15-3/h4-5H2,1-3H3,(H,11,12)

InChI key: InChIKey=CJTDOKKLIFBQFE-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C(C)=O)N=C(CCC)N1

Synonyms:

• Methyl 4-acetyl-2-propyl-1H-imidazole-5-carboxylate
• 1H-Imidazole-5-carboxylic acid, 4-acetyl-2-propyl-, methyl ester