
CAS 122770-40-5
:8-(4-Fluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene
Description:
8-(4-Fluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene, identified by its CAS number 122770-40-5, is a chemical compound characterized by its unique spirocyclic structure, which features a dioxaspiro framework. This compound contains a fluorophenyl group, which contributes to its potential reactivity and biological activity. The presence of the dioxaspiro moiety suggests that it may exhibit interesting conformational properties and could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks. The fluorine atom in the para position of the phenyl ring can enhance the compound's lipophilicity and influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structural features may impart specific physical properties, such as solubility and stability, which are crucial for its application in pharmaceuticals or materials science. Overall, 8-(4-Fluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene represents a class of compounds that may have significant implications in drug development and chemical research.
Formula:C14H15FO2
InChI:InChI=1S/C14H15FO2/c15-13-3-1-11(2-4-13)12-5-7-14(8-6-12)16-9-10-17-14/h1-5H,6-10H2
InChI key:InChIKey=DJECMZKAFHJFMI-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=2CCC3(CC2)OCCO3)C=C1
Synonyms:- 1,4-Dioxaspiro[4.5]dec-7-ene, 8-(4-fluorophenyl)-
- 8-(4-Fluorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
