CAS 122773-97-1
:2-Phenyl-5-pyrimidinecarboxylic acid
Description:
2-Phenyl-5-pyrimidinecarboxylic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a phenyl group attached to the pyrimidine ring, contributing to its aromatic properties and potential for various chemical interactions. The carboxylic acid functional group (-COOH) at the 5-position of the pyrimidine ring imparts acidic characteristics, making it capable of donating protons in solution. This compound may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while its aromatic nature may enhance its stability and reactivity in organic synthesis. Additionally, 2-Phenyl-5-pyrimidinecarboxylic acid may serve as a building block in the synthesis of pharmaceuticals or agrochemicals, owing to its structural features that can facilitate interactions with biological targets. Its unique combination of functional groups allows for diverse applications in medicinal chemistry and material science.
Formula:C11H8N2O2
InChI:InChI=1S/C11H8N2O2/c14-11(15)9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-7H,(H,14,15)
InChI key:InChIKey=BOAIYSRFGWBZCF-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=NC(=NC1)C2=CC=CC=C2
Synonyms:- 2-Phenyl-5-pyrimidinecarboxylic acid
- 2-Phenylpyrimidine-5-carboxylic acid 97%
- 5-Pyrimidinecarboxylic acid, 2-phenyl-
- 5-Pyrimidinecarboxylicacid,2-phenyl-(9CI)
- Asischem A03340
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Pyrimidinecarboxylic acid, 2-phenyl-
CAS:Formula:C11H8N2O2Purity:95%Color and Shape:SolidMolecular weight:200.19342-Phenylpyrimidine-5-carboxylic acid
CAS:2-Phenylpyrimidine-5-carboxylic acidPurity:97%Color and Shape:Off-White SolidMolecular weight:200.19g/mol2-Phenylpyrimidine-5-carboxylic acid
CAS:Formula:C11H8N2O2Purity:98%Color and Shape:No data available.Molecular weight:200.1972-Phenyl-pyrimidine-5-carboxylic acid
CAS:2-Phenyl-pyrimidine-5-carboxylic acid is a hydroxy derivative of pyrimidine carboxylic acid that has an inhibitory effect on xanthine oxidase. It inhibits the production of uric acid from xanthine and hypoxanthine, which results in a decrease in blood pressure and lipid levels. 2-Phenyl-pyrimidine-5-carboxylic acid has been shown to be more potent than other known inhibitors of xanthine oxidase, such as allopurinol, probenecid, or benzbromarone. The molecular modeling study showed that 2-Phenyl-pyrimidine-5-carboxylic acid binds to the active site of the enzyme xanthine oxidase and blocks access to the substrate. Inhibitors of xanthine oxidase are used clinically to treat dyslipidemia and cardiovascular diseases by lowering blood pressure and lipid levelsFormula:C11H8N2O2Purity:Min. 95%Molecular weight:200.2 g/mol



