CymitQuimica logo

CAS 1227935-81-0

:

7-Fluorospiro[2H-1-benzopyran-2,1′-cyclopentan]-4(3H)-one

Description:
7-Fluorospiro[2H-1-benzopyran-2,1′-cyclopentan]-4(3H)-one is a synthetic organic compound characterized by its unique spirocyclic structure, which combines a benzopyran moiety with a cyclopentanone unit. The presence of a fluorine atom at the 7-position of the benzopyran ring significantly influences its chemical properties, including its reactivity and potential biological activity. This compound typically exhibits a range of functional groups, including carbonyl and aromatic systems, which contribute to its chemical behavior. It may be of interest in medicinal chemistry due to its potential pharmacological properties, as compounds with similar structures have been explored for various therapeutic applications. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its structure and purity. Overall, 7-Fluorospiro[2H-1-benzopyran-2,1′-cyclopentan]-4(3H)-one represents a fascinating subject for further research in organic and medicinal chemistry.
Formula:C13H13FO2
InChI:InChI=1S/C13H13FO2/c14-9-3-4-10-11(15)8-13(5-1-2-6-13)16-12(10)7-9/h3-4,7H,1-2,5-6,8H2
InChI key:InChIKey=PWRKFJHPYUYJHE-UHFFFAOYSA-N
SMILES:O=C1CC2(OC=3C1=CC=C(F)C3)CCCC2
Synonyms:
  • 7-Fluorospiro[2H-1-benzopyran-2,1′-cyclopentan]-4(3H)-one
  • Spiro[2H-1-benzopyran-2,1′-cyclopentan]-4(3H)-one, 7-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.