CymitQuimica logo

CAS 1227945-09-6

:

2,5-Pyridinedicarboxylic acid, 4-chloro-, 2,5-dimethyl ester

Description:
2,5-Pyridinedicarboxylic acid, 4-chloro-, 2,5-dimethyl ester is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two carboxylic acid ester groups at the 2 and 5 positions of the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 4-position introduces additional reactivity and influences the compound's physical properties, such as solubility and boiling point. The dimethyl ester groups enhance the compound's lipophilicity, making it more soluble in organic solvents. This compound may be utilized in various chemical reactions, including esterification and nucleophilic substitution, and could serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C9H8ClNO4
InChI:InChI=1S/C9H8ClNO4/c1-14-8(12)5-4-11-7(3-6(5)10)9(13)15-2/h3-4H,1-2H3
InChI key:InChIKey=KSVZJSRVRPYAIE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(Cl)=CC(C(OC)=O)=NC1
Synonyms:
  • 2,5-Dimethyl 4-chloropyridine-2,5-dicarboxylate
  • 2,5-Pyridinedicarboxylic acid, 4-chloro-, 2,5-dimethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.