CAS 1227954-34-8

3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid

Description:

3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. This substance features two chlorine atoms positioned at the 3 and 5 positions of the imidazo ring, enhancing its reactivity and potential biological activity. The carboxylic acid functional group at the 2 position plays a crucial role in its acidity and solubility in polar solvents. The presence of these functional groups suggests that the compound may exhibit significant interactions with biological targets, making it of interest in medicinal chemistry. Its structural complexity allows for various synthetic modifications, which can lead to derivatives with altered pharmacological profiles. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid is a compound of interest for research in drug development and chemical synthesis.

Formula: C₈H₄Cl₂N₂O₂

InChI: InChI=1S/C8H4Cl2N2O2/c9-4-2-1-3-5-11-6(8(13)14)7(10)12(4)5/h1-3H,(H,13,14)

InChI key: InChIKey=OMBATAGDYCDDMJ-UHFFFAOYSA-N

SMILES: ClC=1N2C(=NC1C(O)=O)C=CC=C2Cl

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 3,5-dichloro-
• 3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid

3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid

CAS: 1227954-34-8

3,5-Dichloroimidazo[1,2-a]pyridine-2-carboxylic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 231.04g/mol

Ref: 54-OR48094