CymitQuimica logo

CAS 1227954-60-0

:

3-Bromo-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazole

Description:
3-Bromo-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a tetrahydro-2H-pyran moiety. The presence of the bromine atom introduces a halogen substituent, which can influence the compound's reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyrazole and tetrahydropyran groups, which are often associated with biological activity. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest for synthetic organic chemistry. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.
Formula:C8H11BrN2O
InChI:InChI=1S/C8H11BrN2O/c9-8-1-4-11(10-8)7-2-5-12-6-3-7/h1,4,7H,2-3,5-6H2
InChI key:InChIKey=NLOYYLLCFSUQPE-UHFFFAOYSA-N
SMILES:BrC1=NN(C=C1)C2CCOCC2
Synonyms:
  • 1H-Pyrazole, 3-bromo-1-(tetrahydro-2H-pyran-4-yl)-
  • 3-Bromo-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.