CAS 1227954-64-4

1,1-Dimethylethyl 4-[2-(3-bromophenoxy)ethyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[2-(3-bromophenoxy)ethyl]-1-piperazinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a carboxylate group, and a bromophenoxy substituent. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of various functional groups, making it potentially useful in pharmaceutical applications. The piperazine moiety is known for its biological activity, often serving as a scaffold in drug design. The bromophenoxy group may enhance the compound's interaction with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. Additionally, the presence of the tert-butyl group (1,1-dimethylethyl) can contribute to the compound's stability and solubility characteristics. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its biological activity and potential uses.

Formula: C₁₇H₂₅BrN₂O₃

InChI: InChI=1S/C17H25BrN2O3/c1-17(2,3)23-16(21)20-9-7-19(8-10-20)11-12-22-15-6-4-5-14(18)13-15/h4-6,13H,7-12H2,1-3H3

InChI key: InChIKey=HQGHEGRFJLUEFR-UHFFFAOYSA-N

SMILES: C(COC1=CC(Br)=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 4-[2-(3-bromophenoxy)ethyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[2-(3-bromophenoxy)ethyl]-, 1,1-dimethylethyl ester

tert-Butyl 4-[2-(3-bromophenoxy)ethyl]piperazine-1-carboxylate

CAS: 1227954-64-4

tert-Butyl 4-[2-(3-bromophenoxy)ethyl]piperazine-1-carboxylate

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 385.30g/mol

Ref: 54-OR110584