CAS 1227954-72-4
:4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]hexahydro-1H-1,4-diazepine-1-propanoic acid
Description:
4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]hexahydro-1H-1,4-diazepine-1-propanoic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom and a trifluoromethyl group. The presence of the hexahydro-1H-1,4-diazepine moiety indicates that it contains a bicyclic structure, contributing to its potential biological activity. This compound is likely to exhibit properties typical of both pyridine derivatives and amino acids, which may include interactions with biological receptors or enzymes. The trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. Additionally, the carboxylic acid functional group suggests potential for forming salts or participating in hydrogen bonding, which can influence solubility and reactivity. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C14H17ClF3N3O2
InChI:InChI=1S/C14H17ClF3N3O2/c15-11-8-10(14(16,17)18)9-19-13(11)21-4-1-3-20(6-7-21)5-2-12(22)23/h8-9H,1-7H2,(H,22,23)
InChI key:InChIKey=QFXOLRGPLPIHJC-UHFFFAOYSA-N
SMILES:ClC1=C(N=CC(C(F)(F)F)=C1)N2CCN(CCC(O)=O)CCC2
Synonyms:- 4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]hexahydro-1H-1,4-diazepine-1-propanoic acid
- 1H-1,4-Diazepine-1-propanoic acid, 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]homopiperazin-1-yl}propanoic acid
CAS:3-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]homopiperazin-1-yl}propanoic acid
Molecular weight:351.75g/mol
