CAS 1227954-77-9

Imidazo[1,2-a]pyridine-3-methanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-3-methanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which incorporates a fused bicyclic system featuring both imidazole and pyridine rings. The presence of a methanamine group at the 3-position and a dimethylamino substituent at the 6-position contributes to its basicity and potential reactivity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, solubility, and spectral characteristics, would depend on the conditions of synthesis and purification. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Safety and handling precautions should be observed due to the potential biological activity and toxicity associated with similar compounds.

Formula: C₁₀H₁₂ClN₃·ClH

InChI: InChI=1S/C10H12ClN3.ClH/c1-13(2)7-9-5-12-10-4-3-8(11)6-14(9)10;/h3-6H,7H2,1-2H3;1H

InChI key: InChIKey=SWKGTRDZOXYLDQ-UHFFFAOYSA-N

SMILES: C(N(C)C)C=1N2C(=NC1)C=CC(Cl)=C2.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-3-methanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:1)

6-Chloro-3-[(dimethylamino)methyl]imidazo[1,2-a]pyridine hydrochloride

CAS: 1227954-77-9

6-Chloro-3-[(dimethylamino)methyl]imidazo[1,2-a]pyridine hydrochloride

Purity: ≥95%

Molecular weight: 246.14g/mol

Ref: 54-OR40602