CymitQuimica logo

CAS 1227954-78-0

:

N,N-Dimethyl-4-[[4-(trifluoromethyl)-2-pyrimidinyl]oxy]benzenesulfonamide

Description:
N,N-Dimethyl-4-[[4-(trifluoromethyl)-2-pyrimidinyl]oxy]benzenesulfonamide, identified by its CAS number 1227954-78-0, is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a pyrimidine ring, and a trifluoromethyl substituent. This compound typically exhibits properties such as high solubility in polar solvents due to the presence of the sulfonamide functional group, which can engage in hydrogen bonding. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The compound may also demonstrate specific reactivity patterns typical of sulfonamides, including potential interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutics targeting various diseases. Additionally, the presence of fluorine atoms can enhance metabolic stability and bioavailability. Overall, this compound's unique features make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C13H12F3N3O3S
InChI:InChI=1S/C13H12F3N3O3S/c1-19(2)23(20,21)10-5-3-9(4-6-10)22-12-17-8-7-11(18-12)13(14,15)16/h3-8H,1-2H3
InChI key:InChIKey=GIEODSOJPNTADM-UHFFFAOYSA-N
SMILES:O(C=1N=C(C(F)(F)F)C=CN1)C2=CC=C(S(N(C)C)(=O)=O)C=C2
Synonyms:
  • Benzenesulfonamide, N,N-dimethyl-4-[[4-(trifluoromethyl)-2-pyrimidinyl]oxy]-
  • N,N-Dimethyl-4-[[4-(trifluoromethyl)-2-pyrimidinyl]oxy]benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.