CymitQuimica logo

CAS 1227954-94-0

:

1-[4-[[4-(Trifluoromethyl)-2-pyrimidinyl]oxy]phenyl]ethanone

Description:
1-[4-[[4-(Trifluoromethyl)-2-pyrimidinyl]oxy]phenyl]ethanone, identified by its CAS number 1227954-94-0, is a chemical compound characterized by its complex structure, which includes a trifluoromethyl group and a pyrimidine moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The ether linkage between the pyrimidine and phenyl groups contributes to its overall polarity and solubility characteristics. Additionally, the ketone functional group is likely to participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H9F3N2O2
InChI:InChI=1S/C13H9F3N2O2/c1-8(19)9-2-4-10(5-3-9)20-12-17-7-6-11(18-12)13(14,15)16/h2-7H,1H3
InChI key:InChIKey=UYVULMVVFRPTDB-UHFFFAOYSA-N
SMILES:O(C=1N=C(C(F)(F)F)C=CN1)C2=CC=C(C(C)=O)C=C2
Synonyms:
  • 1-[4-[[4-(Trifluoromethyl)-2-pyrimidinyl]oxy]phenyl]ethanone
  • Ethanone, 1-[4-[[4-(trifluoromethyl)-2-pyrimidinyl]oxy]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.