CAS 1227955-14-7

8-Bromo-1,5,6,7-tetrahydro-5,5,7,7-tetramethyl-4-nitrocyclopent[f]indazole

Description:

8-Bromo-1,5,6,7-tetrahydro-5,5,7,7-tetramethyl-4-nitrocyclopent[f]indazole is a synthetic organic compound characterized by its complex bicyclic structure, which includes a nitro group and a bromine substituent. This compound features a tetrahydroindazole framework, indicating it has undergone partial hydrogenation, contributing to its saturated nature. The presence of multiple methyl groups enhances its hydrophobic characteristics, while the nitro group introduces polar functionality, which can influence its reactivity and solubility in various solvents. The bromine atom serves as a potential site for further chemical modifications, making it a versatile intermediate in organic synthesis. This compound may exhibit interesting biological activities, although specific pharmacological data may vary. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₆BrN₃O₂

InChI: InChI=1S/C14H16BrN3O2/c1-13(2)6-14(3,4)9-8(13)10(15)11-7(5-16-17-11)12(9)18(19)20/h5H,6H2,1-4H3,(H,16,17)

InChI key: InChIKey=ZEXHJACCIBZJDD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=C(Br)C3=C1C=NN3)C(C)(C)CC2(C)C

Synonyms:

• Cyclopent[f]indazole, 8-bromo-1,5,6,7-tetrahydro-5,5,7,7-tetramethyl-4-nitro-
• 8-Bromo-1,5,6,7-tetrahydro-5,5,7,7-tetramethyl-4-nitrocyclopent[f]indazole

8-Bromo-5,5,7,7-tetramethyl-4-nitro-1,5,6,7-tetrahydrocyclopenta[f]indazole

CAS: 1227955-14-7

8-Bromo-5,5,7,7-tetramethyl-4-nitro-1,5,6,7-tetrahydrocyclopenta[f]indazole

Purity: ≥95%

Molecular weight: 338.20g/mol

Ref: 54-OR110241