CAS 1227955-25-0

N-(4-Methylphenyl)-N′-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]urea

Description:

N-(4-Methylphenyl)-N′-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]urea, identified by its CAS number 1227955-25-0, is a chemical compound that belongs to the class of ureas. This substance features a urea functional group, which is characterized by the presence of two amine groups attached to a carbonyl carbon. The compound exhibits a complex structure due to the presence of a 4-methylphenyl group and a pyridine ring that is further substituted with a methyl group and a trifluoromethyl group. These substituents contribute to its unique chemical properties, including potential lipophilicity and biological activity. The trifluoromethyl group, in particular, is known to enhance the metabolic stability and bioactivity of organic compounds. This compound may be of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents, due to its potential interactions with biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary significantly based on environmental conditions and the presence of other chemical species.

Formula: C₁₅H₁₄F₃N₃O

InChI: InChI=1S/C15H14F3N3O/c1-9-3-5-11(6-4-9)20-14(22)21-12-7-8-13(15(16,17)18)19-10(12)2/h3-8H,1-2H3,(H2,20,21,22)

InChI key: InChIKey=JEUSTCYXKSIALI-UHFFFAOYSA-N

SMILES: N(C(NC1=CC=C(C)C=C1)=O)C2=C(C)N=C(C(F)(F)F)C=C2

Synonyms:

• N-(4-Methylphenyl)-N′-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]urea
• Urea, N-(4-methylphenyl)-N′-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-